C16H10ClF3O3 — CID 4530933
1-(5-chloro-2-hydroxyphenyl)-3-[4-(trifluoromethyl)phenyl]propane-1,3-dione (PubChem CID 4530933) has the molecular formula C16H10ClF3O3 and a molecular weight of 342.70 g/mol. Its IUPAC name is 1-(5-chloro-2-hydroxyphenyl)-3-[4-(trifluoromethyl)phenyl]propane-1,3-dione.
| Compound Name | 1-(5-chloro-2-hydroxyphenyl)-3-[4-(trifluoromethyl)phenyl]propane-1,3-dione |
|---|---|
| PubChem CID | 4530933 |
| Molecular Formula | C16H10ClF3O3 |
| Molecular Weight | 342.70 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 1-(5-chloro-2-hydroxyphenyl)-3-[4-(trifluoromethyl)phenyl]propane-1,3-dione |
| SMILES | O=C(CC(=O)c1cc(Cl)ccc1O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H10ClF3O3/c17-11-5-6-13(21)12(7-11)15(23)8-14(22)9-1-3-10(4-2-9)16(18,19)20/h1-7,21H,8H2 |
| InChIKey | YBHPBXQWJVFAHI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.70 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|