C19H15ClF3NO5 — CID 10916983
ethyl 3-[2-(5-chloro-2-hydroxybenzoyl)-4-(trifluoromethyl)anilino]-3-oxopropanoate (PubChem CID 10916983) has the molecular formula C19H15ClF3NO5 and a molecular weight of 429.78 g/mol. Its IUPAC name is ethyl 3-[2-(5-chloro-2-hydroxybenzoyl)-4-(trifluoromethyl)anilino]-3-oxopropanoate.
| Compound Name | ethyl 3-[2-(5-chloro-2-hydroxybenzoyl)-4-(trifluoromethyl)anilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 10916983 |
| Molecular Formula | C19H15ClF3NO5 |
| Molecular Weight | 429.78 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | ethyl 3-[2-(5-chloro-2-hydroxybenzoyl)-4-(trifluoromethyl)anilino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)Nc1ccc(C(F)(F)F)cc1C(=O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C19H15ClF3NO5/c1-2-29-17(27)9-16(26)24-14-5-3-10(19(21,22)23)7-12(14)18(28)13-8-11(20)4-6-15(13)25/h3-8,25H,2,9H2,1H3,(H,24,26) |
| InChIKey | JYPYDLBKPMXURD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.78 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|