C14H14F3NO4 — CID 67133787
ethyl 3-[2-acetyl-5-(trifluoromethyl)anilino]-3-oxopropanoate (PubChem CID 67133787) has the molecular formula C14H14F3NO4 and a molecular weight of 317.26 g/mol. Its IUPAC name is ethyl 3-[2-acetyl-5-(trifluoromethyl)anilino]-3-oxopropanoate.
| Compound Name | ethyl 3-[2-acetyl-5-(trifluoromethyl)anilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 67133787 |
| Molecular Formula | C14H14F3NO4 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | ethyl 3-[2-acetyl-5-(trifluoromethyl)anilino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)Nc1cc(C(F)(F)F)ccc1C(C)=O |
| InChI | InChI=1S/C14H14F3NO4/c1-3-22-13(21)7-12(20)18-11-6-9(14(15,16)17)4-5-10(11)8(2)19/h4-6H,3,7H2,1-2H3,(H,18,20) |
| InChIKey | LBKJLJGYDWUBCG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|