C15H14F6O3 — CID 146008654
ethyl 5-[2,4-bis(trifluoromethyl)phenyl]-5-oxopentanoate (PubChem CID 146008654) has the molecular formula C15H14F6O3 and a molecular weight of 356.26 g/mol. Its IUPAC name is ethyl 5-[2,4-bis(trifluoromethyl)phenyl]-5-oxopentanoate.
| Compound Name | ethyl 5-[2,4-bis(trifluoromethyl)phenyl]-5-oxopentanoate |
|---|---|
| PubChem CID | 146008654 |
| Molecular Formula | C15H14F6O3 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | ethyl 5-[2,4-bis(trifluoromethyl)phenyl]-5-oxopentanoate |
| SMILES | CCOC(=O)CCCC(=O)c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C15H14F6O3/c1-2-24-13(23)5-3-4-12(22)10-7-6-9(14(16,17)18)8-11(10)15(19,20)21/h6-8H,2-5H2,1H3 |
| InChIKey | SJTRJJPBRMLGKX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |