C13H10F6O3 — CID 146008638
methyl 4-[2,4-bis(trifluoromethyl)phenyl]-4-oxobutanoate (PubChem CID 146008638) has the molecular formula C13H10F6O3 and a molecular weight of 328.21 g/mol. Its IUPAC name is methyl 4-[2,4-bis(trifluoromethyl)phenyl]-4-oxobutanoate.
| Compound Name | methyl 4-[2,4-bis(trifluoromethyl)phenyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 146008638 |
| Molecular Formula | C13H10F6O3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | methyl 4-[2,4-bis(trifluoromethyl)phenyl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C13H10F6O3/c1-22-11(21)5-4-10(20)8-3-2-7(12(14,15)16)6-9(8)13(17,18)19/h2-3,6H,4-5H2,1H3 |
| InChIKey | FUMGHZLFAOWATO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |