C11H10F3IO2 — CID 129319237
methyl 3-[2-iodo-5-(trifluoromethyl)phenyl]propanoate (PubChem CID 129319237) has the molecular formula C11H10F3IO2 and a molecular weight of 358.10 g/mol. Its IUPAC name is methyl 3-[2-iodo-5-(trifluoromethyl)phenyl]propanoate.
| Compound Name | methyl 3-[2-iodo-5-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 129319237 |
| Molecular Formula | C11H10F3IO2 |
| Molecular Weight | 358.10 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | methyl 3-[2-iodo-5-(trifluoromethyl)phenyl]propanoate |
| SMILES | COC(=O)CCc1cc(C(F)(F)F)ccc1I |
| InChI | InChI=1S/C11H10F3IO2/c1-17-10(16)5-2-7-6-8(11(12,13)14)3-4-9(7)15/h3-4,6H,2,5H2,1H3 |
| InChIKey | NVFQLHSNCOQDAK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.10 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|