C12H11F3O4 — CID 82550609
methyl 4-[2-hydroxy-5-(trifluoromethyl)phenyl]-4-oxobutanoate (PubChem CID 82550609) has the molecular formula C12H11F3O4 and a molecular weight of 276.21 g/mol. Its IUPAC name is methyl 4-[2-hydroxy-5-(trifluoromethyl)phenyl]-4-oxobutanoate.
| Compound Name | methyl 4-[2-hydroxy-5-(trifluoromethyl)phenyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 82550609 |
| Molecular Formula | C12H11F3O4 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | methyl 4-[2-hydroxy-5-(trifluoromethyl)phenyl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)c1cc(C(F)(F)F)ccc1O |
| InChI | InChI=1S/C12H11F3O4/c1-19-11(18)5-4-10(17)8-6-7(12(13,14)15)2-3-9(8)16/h2-3,6,16H,4-5H2,1H3 |
| InChIKey | XPJROYDGIKXEGB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |