C20H21F3O2S — CID 69436110
methyl 3-[2-(4-ethylsulfanyl-2-methylphenyl)-4-(trifluoromethyl)phenyl]propanoate (PubChem CID 69436110) has the molecular formula C20H21F3O2S and a molecular weight of 382.45 g/mol. Its IUPAC name is methyl 3-[2-(4-ethylsulfanyl-2-methylphenyl)-4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | methyl 3-[2-(4-ethylsulfanyl-2-methylphenyl)-4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 69436110 |
| Molecular Formula | C20H21F3O2S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | methyl 3-[2-(4-ethylsulfanyl-2-methylphenyl)-4-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCSc1ccc(-c2cc(C(F)(F)F)ccc2CCC(=O)OC)c(C)c1 |
| InChI | InChI=1S/C20H21F3O2S/c1-4-26-16-8-9-17(13(2)11-16)18-12-15(20(21,22)23)7-5-14(18)6-10-19(24)25-3/h5,7-9,11-12H,4,6,10H2,1-3H3 |
| InChIKey | KWVPXSCSJSFWOJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |