C26H25F3O2S — CID 90747453
[2-methyl-4-[1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethylsulfanyl]phenyl] butanoate (PubChem CID 90747453) has the molecular formula C26H25F3O2S and a molecular weight of 458.55 g/mol. Its IUPAC name is [2-methyl-4-[1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethylsulfanyl]phenyl] butanoate.
| Compound Name | [2-methyl-4-[1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethylsulfanyl]phenyl] butanoate |
|---|---|
| PubChem CID | 90747453 |
| Molecular Formula | C26H25F3O2S |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | [2-methyl-4-[1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethylsulfanyl]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccc(SC(C)c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)cc1C |
| InChI | InChI=1S/C26H25F3O2S/c1-4-5-25(30)31-24-15-14-23(16-17(24)2)32-18(3)19-6-8-20(9-7-19)21-10-12-22(13-11-21)26(27,28)29/h6-16,18H,4-5H2,1-3H3 |
| InChIKey | KZQZCVGCMMSTQB-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|