C16H21F3O2 — CID 145448297
[2-methyl-1-[3-methyl-5-(trifluoromethyl)phenyl]propyl] butanoate (PubChem CID 145448297) has the molecular formula C16H21F3O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is [2-methyl-1-[3-methyl-5-(trifluoromethyl)phenyl]propyl] butanoate.
| Compound Name | [2-methyl-1-[3-methyl-5-(trifluoromethyl)phenyl]propyl] butanoate |
|---|---|
| PubChem CID | 145448297 |
| Molecular Formula | C16H21F3O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [2-methyl-1-[3-methyl-5-(trifluoromethyl)phenyl]propyl] butanoate |
| SMILES | CCCC(=O)OC(c1cc(C)cc(C(F)(F)F)c1)C(C)C |
| InChI | InChI=1S/C16H21F3O2/c1-5-6-14(20)21-15(10(2)3)12-7-11(4)8-13(9-12)16(17,18)19/h7-10,15H,5-6H2,1-4H3 |
| InChIKey | MKRYYSJHPITGQJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |