C18H25F3O3 — CID 145114722
[(3R)-4-methyl-3-[4-(trifluoromethyl)phenoxy]pentan-2-yl] pentanoate (PubChem CID 145114722) has the molecular formula C18H25F3O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is [(3R)-4-methyl-3-[4-(trifluoromethyl)phenoxy]pentan-2-yl] pentanoate.
| Compound Name | [(3R)-4-methyl-3-[4-(trifluoromethyl)phenoxy]pentan-2-yl] pentanoate |
|---|---|
| PubChem CID | 145114722 |
| Molecular Formula | C18H25F3O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [(3R)-4-methyl-3-[4-(trifluoromethyl)phenoxy]pentan-2-yl] pentanoate |
| SMILES | CCCCC(=O)OC(C)[C@H](Oc1ccc(C(F)(F)F)cc1)C(C)C |
| InChI | InChI=1S/C18H25F3O3/c1-5-6-7-16(22)23-13(4)17(12(2)3)24-15-10-8-14(9-11-15)18(19,20)21/h8-13,17H,5-7H2,1-4H3/t13?,17-/m1/s1 |
| InChIKey | GBYHIHDDCQOQAR-LRHAYUFXSA-N |
| XLogP | 5.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |