About [2-fluoro-4-(4-fluorophenyl)phenyl] butanoate;[2-fluoro-4-(4-fluorophenyl)phenyl] propanoate
[2-fluoro-4-(4-fluorophenyl)phenyl] butanoate;[2-fluoro-4-(4-fluorophenyl)phenyl] propanoate (PubChem CID 23174129) has the molecular formula C31H26F4O4
and a molecular weight of 538.54 g/mol. Its IUPAC name is [2-fluoro-4-(4-fluorophenyl)phenyl] butanoate;[2-fluoro-4-(4-fluorophenyl)phenyl] propanoate.
Molecular Properties
| Compound Name | [2-fluoro-4-(4-fluorophenyl)phenyl] butanoate;[2-fluoro-4-(4-fluorophenyl)phenyl] propanoate |
| PubChem CID | 23174129 |
| Molecular Formula | C31H26F4O4 |
| Molecular Weight | 538.54 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | [2-fluoro-4-(4-fluorophenyl)phenyl] butanoate;[2-fluoro-4-(4-fluorophenyl)phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(-c2ccc(F)cc2)cc1F.CCCC(=O)Oc1ccc(-c2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C16H14F2O2.C15H12F2O2/c1-2-3-16(19)20-15-9-6-12(10-14(15)18)11-4-7-13(17)8-5-11;1-2-15(18)19-14-8-5-11(9-13(14)17)10-3-6-12(16)7-4-10/h4-10H,2-3H2,1H3;3-9H,2H2,1H3 |
| InChIKey | VNERBZFUOPLACL-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.54 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-fluoro-4-(4-fluorophenyl)phenyl] butanoate;[2-fluoro-4-(4-fluorophenyl)phenyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-fluoro-4-(4-fluorophenyl)phenyl] butanoate;[2-fluoro-4-(4-fluorophenyl)phenyl] propanoate?
The IUPAC name of [2-fluoro-4-(4-fluorophenyl)phenyl] butanoate;[2-fluoro-4-(4-fluorophenyl)phenyl] propanoate (CID 23174129) is [2-fluoro-4-(4-fluorophenyl)phenyl] butanoate;[2-fluoro-4-(4-fluorophenyl)phenyl] propanoate.
What is the SMILES notation for [2-fluoro-4-(4-fluorophenyl)phenyl] butanoate;[2-fluoro-4-(4-fluorophenyl)phenyl] propanoate?
The canonical SMILES for [2-fluoro-4-(4-fluorophenyl)phenyl] butanoate;[2-fluoro-4-(4-fluorophenyl)phenyl] propanoate is CCC(=O)Oc1ccc(-c2ccc(F)cc2)cc1F.CCCC(=O)Oc1ccc(-c2ccc(F)cc2)cc1F.
What is the InChIKey of [2-fluoro-4-(4-fluorophenyl)phenyl] butanoate;[2-fluoro-4-(4-fluorophenyl)phenyl] propanoate?
The InChIKey is VNERBZFUOPLACL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F2O2.C15H12F2O2/c1-2-3-16(19)20-15-9-6-12(10-14(15)18)11-4-7-13(17)8-5-11;1-2-15(18)19-14-8-5-11(9-13(14)17)10-3-6-12(16)7-4-10/h4-10H,2-3H2,1H3;3-9H,2H2,1H3.
What are the key properties of [2-fluoro-4-(4-fluorophenyl)phenyl] butanoate;[2-fluoro-4-(4-fluorophenyl)phenyl] propanoate?
[2-fluoro-4-(4-fluorophenyl)phenyl] butanoate;[2-fluoro-4-(4-fluorophenyl)phenyl] propanoate has a molecular weight of 538.54 g/mol, XLogP of 8.28, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-fluoro-4-(4-fluorophenyl)phenyl] butanoate;[2-fluoro-4-(4-fluorophenyl)phenyl] propanoate is sourced from PubChem (CID 23174129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).