C14H8BrClF3NO2 — CID 71381236
N-[2-bromo-5-(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide (PubChem CID 71381236) has the molecular formula C14H8BrClF3NO2 and a molecular weight of 394.57 g/mol. Its IUPAC name is N-[2-bromo-5-(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide.
| Compound Name | N-[2-bromo-5-(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 71381236 |
| Molecular Formula | C14H8BrClF3NO2 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 392.94 |
| IUPAC Name | N-[2-bromo-5-(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Br)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C14H8BrClF3NO2/c15-10-3-1-7(14(17,18)19)5-11(10)20-13(22)9-6-8(16)2-4-12(9)21/h1-6,21H,(H,20,22) |
| InChIKey | HPPBXPSXCFGKJZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |