C14H8BrF4NO — CID 63049440
2-bromo-N-[2-fluoro-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 63049440) has the molecular formula C14H8BrF4NO and a molecular weight of 362.12 g/mol. Its IUPAC name is 2-bromo-N-[2-fluoro-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-bromo-N-[2-fluoro-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 63049440 |
| Molecular Formula | C14H8BrF4NO |
| Molecular Weight | 362.12 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | 2-bromo-N-[2-fluoro-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1F)c1ccccc1Br |
| InChI | InChI=1S/C14H8BrF4NO/c15-10-4-2-1-3-9(10)13(21)20-12-7-8(14(17,18)19)5-6-11(12)16/h1-7H,(H,20,21) |
| InChIKey | AJVLOTXASCRMTF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.12 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |