C10H7Cl4NO2 — CID 7313162
4,4,4-trichloro-1-(5-chloro-2-hydroxyphenyl)-3-iminobutan-1-one (PubChem CID 7313162) has the molecular formula C10H7Cl4NO2 and a molecular weight of 314.98 g/mol. Its IUPAC name is 4,4,4-trichloro-1-(5-chloro-2-hydroxyphenyl)-3-iminobutan-1-one.
| Compound Name | 4,4,4-trichloro-1-(5-chloro-2-hydroxyphenyl)-3-iminobutan-1-one |
|---|---|
| PubChem CID | 7313162 |
| Molecular Formula | C10H7Cl4NO2 |
| Molecular Weight | 314.98 g/mol |
| Exact Mass | 312.92 |
| IUPAC Name | 4,4,4-trichloro-1-(5-chloro-2-hydroxyphenyl)-3-iminobutan-1-one |
| SMILES | [H]/N=C(/CC(=O)c1cc(Cl)ccc1O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H7Cl4NO2/c11-5-1-2-7(16)6(3-5)8(17)4-9(15)10(12,13)14/h1-3,15-16H,4H2/b15-9- |
| InChIKey | HSJDAAMMZAISIB-DHDCSXOGSA-N |
| XLogP | 4.01 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.98 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|