C15H10F4N2O4S — CID 3973664
N-[[2-(difluoromethylsulfonyl)phenyl]carbamoyl]-2,6-difluorobenzamide (PubChem CID 3973664) has the molecular formula C15H10F4N2O4S and a molecular weight of 390.31 g/mol. Its IUPAC name is N-[[2-(difluoromethylsulfonyl)phenyl]carbamoyl]-2,6-difluorobenzamide.
| Compound Name | N-[[2-(difluoromethylsulfonyl)phenyl]carbamoyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 3973664 |
| Molecular Formula | C15H10F4N2O4S |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | N-[[2-(difluoromethylsulfonyl)phenyl]carbamoyl]-2,6-difluorobenzamide |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Nc1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C15H10F4N2O4S/c16-8-4-3-5-9(17)12(8)13(22)21-15(23)20-10-6-1-2-7-11(10)26(24,25)14(18)19/h1-7,14H,(H2,20,21,22,23) |
| InChIKey | LTAPUDXMECZIFJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |