C24H16ClFN2O2S — CID 57245040
2-chloro-6-fluoro-N-[(4-naphthalen-1-ylsulfanylphenyl)carbamoyl]benzamide (PubChem CID 57245040) has the molecular formula C24H16ClFN2O2S and a molecular weight of 450.92 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-[(4-naphthalen-1-ylsulfanylphenyl)carbamoyl]benzamide.
| Compound Name | 2-chloro-6-fluoro-N-[(4-naphthalen-1-ylsulfanylphenyl)carbamoyl]benzamide |
|---|---|
| PubChem CID | 57245040 |
| Molecular Formula | C24H16ClFN2O2S |
| Molecular Weight | 450.92 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 2-chloro-6-fluoro-N-[(4-naphthalen-1-ylsulfanylphenyl)carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1c(F)cccc1Cl)Nc1ccc(Sc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C24H16ClFN2O2S/c25-19-8-4-9-20(26)22(19)23(29)28-24(30)27-16-11-13-17(14-12-16)31-21-10-3-6-15-5-1-2-7-18(15)21/h1-14H,(H2,27,28,29,30) |
| InChIKey | REBXIFFSLJSCMQ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.92 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |