C20H15Cl2FN2OS — CID 2812307
1-[[2-chloro-6-(4-chlorophenyl)sulfanylphenyl]methyl]-3-(4-fluorophenyl)urea (PubChem CID 2812307) has the molecular formula C20H15Cl2FN2OS and a molecular weight of 421.32 g/mol. Its IUPAC name is 1-[[2-chloro-6-(4-chlorophenyl)sulfanylphenyl]methyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[[2-chloro-6-(4-chlorophenyl)sulfanylphenyl]methyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 2812307 |
| Molecular Formula | C20H15Cl2FN2OS |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | 1-[[2-chloro-6-(4-chlorophenyl)sulfanylphenyl]methyl]-3-(4-fluorophenyl)urea |
| SMILES | O=C(NCc1c(Cl)cccc1Sc1ccc(Cl)cc1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C20H15Cl2FN2OS/c21-13-4-10-16(11-5-13)27-19-3-1-2-18(22)17(19)12-24-20(26)25-15-8-6-14(23)7-9-15/h1-11H,12H2,(H2,24,25,26) |
| InChIKey | PVGPVDXYKKQDFT-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |