C13H9ClF2OS — CID 63814768
[2-chloro-6-(3,4-difluorophenyl)sulfanylphenyl]methanol (PubChem CID 63814768) has the molecular formula C13H9ClF2OS and a molecular weight of 286.73 g/mol. Its IUPAC name is [2-chloro-6-(3,4-difluorophenyl)sulfanylphenyl]methanol.
| Compound Name | [2-chloro-6-(3,4-difluorophenyl)sulfanylphenyl]methanol |
|---|---|
| PubChem CID | 63814768 |
| Molecular Formula | C13H9ClF2OS |
| Molecular Weight | 286.73 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | [2-chloro-6-(3,4-difluorophenyl)sulfanylphenyl]methanol |
| SMILES | OCc1c(Cl)cccc1Sc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H9ClF2OS/c14-10-2-1-3-13(9(10)7-17)18-8-4-5-11(15)12(16)6-8/h1-6,17H,7H2 |
| InChIKey | BUSBQHWJMPDBLB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.73 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |