C16H18ClNS — CID 63820479
2-[2-chloro-6-(3,4-dimethylphenyl)sulfanylphenyl]ethanamine (PubChem CID 63820479) has the molecular formula C16H18ClNS and a molecular weight of 291.85 g/mol. Its IUPAC name is 2-[2-chloro-6-(3,4-dimethylphenyl)sulfanylphenyl]ethanamine.
| Compound Name | 2-[2-chloro-6-(3,4-dimethylphenyl)sulfanylphenyl]ethanamine |
|---|---|
| PubChem CID | 63820479 |
| Molecular Formula | C16H18ClNS |
| Molecular Weight | 291.85 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-[2-chloro-6-(3,4-dimethylphenyl)sulfanylphenyl]ethanamine |
| SMILES | Cc1ccc(Sc2cccc(Cl)c2CCN)cc1C |
| InChI | InChI=1S/C16H18ClNS/c1-11-6-7-13(10-12(11)2)19-16-5-3-4-15(17)14(16)8-9-18/h3-7,10H,8-9,18H2,1-2H3 |
| InChIKey | AULSLSFUGNOPTL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.85 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |