C14H14ClNS — CID 113458839
2-chloro-6-(3,4-dimethylphenyl)sulfanylaniline (PubChem CID 113458839) has the molecular formula C14H14ClNS and a molecular weight of 263.79 g/mol. Its IUPAC name is 2-chloro-6-(3,4-dimethylphenyl)sulfanylaniline.
| Compound Name | 2-chloro-6-(3,4-dimethylphenyl)sulfanylaniline |
|---|---|
| PubChem CID | 113458839 |
| Molecular Formula | C14H14ClNS |
| Molecular Weight | 263.79 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 2-chloro-6-(3,4-dimethylphenyl)sulfanylaniline |
| SMILES | Cc1ccc(Sc2cccc(Cl)c2N)cc1C |
| InChI | InChI=1S/C14H14ClNS/c1-9-6-7-11(8-10(9)2)17-13-5-3-4-12(15)14(13)16/h3-8H,16H2,1-2H3 |
| InChIKey | KQIHPLPMCMPOQP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.79 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|