C15H17NS — CID 43528946
[2-(3,4-dimethylphenyl)sulfanylphenyl]methanamine (PubChem CID 43528946) has the molecular formula C15H17NS and a molecular weight of 243.38 g/mol. Its IUPAC name is [2-(3,4-dimethylphenyl)sulfanylphenyl]methanamine.
| Compound Name | [2-(3,4-dimethylphenyl)sulfanylphenyl]methanamine |
|---|---|
| PubChem CID | 43528946 |
| Molecular Formula | C15H17NS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | [2-(3,4-dimethylphenyl)sulfanylphenyl]methanamine |
| SMILES | Cc1ccc(Sc2ccccc2CN)cc1C |
| InChI | InChI=1S/C15H17NS/c1-11-7-8-14(9-12(11)2)17-15-6-4-3-5-13(15)10-16/h3-9H,10,16H2,1-2H3 |
| InChIKey | YOUNWMOBNRWHBW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |