C14H12F2OS — CID 78951586
(1S)-1-[2-(3,4-difluorophenyl)sulfanylphenyl]ethanol (PubChem CID 78951586) has the molecular formula C14H12F2OS and a molecular weight of 266.31 g/mol. Its IUPAC name is (1S)-1-[2-(3,4-difluorophenyl)sulfanylphenyl]ethanol.
| Compound Name | (1S)-1-[2-(3,4-difluorophenyl)sulfanylphenyl]ethanol |
|---|---|
| PubChem CID | 78951586 |
| Molecular Formula | C14H12F2OS |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | (1S)-1-[2-(3,4-difluorophenyl)sulfanylphenyl]ethanol |
| SMILES | C[C@H](O)c1ccccc1Sc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H12F2OS/c1-9(17)11-4-2-3-5-14(11)18-10-6-7-12(15)13(16)8-10/h2-9,17H,1H3/t9-/m0/s1 |
| InChIKey | PIVQXBXUDSBVSE-VIFPVBQESA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |