C13H10F2OS — CID 63812967
[2-(3,4-difluorophenyl)sulfanylphenyl]methanol (PubChem CID 63812967) has the molecular formula C13H10F2OS and a molecular weight of 252.28 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)sulfanylphenyl]methanol.
| Compound Name | [2-(3,4-difluorophenyl)sulfanylphenyl]methanol |
|---|---|
| PubChem CID | 63812967 |
| Molecular Formula | C13H10F2OS |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | [2-(3,4-difluorophenyl)sulfanylphenyl]methanol |
| SMILES | OCc1ccccc1Sc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H10F2OS/c14-11-6-5-10(7-12(11)15)17-13-4-2-1-3-9(13)8-16/h1-7,16H,8H2 |
| InChIKey | OLCOPABPMZFXMX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |