About 1-[2-(4-fluoro-3-methoxyphenyl)sulfanylphenyl]-N,N-dimethylmethanamine;hydrochloride
1-[2-(4-fluoro-3-methoxyphenyl)sulfanylphenyl]-N,N-dimethylmethanamine;hydrochloride (PubChem CID 67632592) has the molecular formula C16H19ClFNOS
and a molecular weight of 327.85 g/mol. Its IUPAC name is 1-[2-(4-fluoro-3-methoxyphenyl)sulfanylphenyl]-N,N-dimethylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-[2-(4-fluoro-3-methoxyphenyl)sulfanylphenyl]-N,N-dimethylmethanamine;hydrochloride |
| PubChem CID | 67632592 |
| Molecular Formula | C16H19ClFNOS |
| Molecular Weight | 327.85 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 1-[2-(4-fluoro-3-methoxyphenyl)sulfanylphenyl]-N,N-dimethylmethanamine;hydrochloride |
| SMILES | COc1cc(Sc2ccccc2CN(C)C)ccc1F.Cl |
| InChI | InChI=1S/C16H18FNOS.ClH/c1-18(2)11-12-6-4-5-7-16(12)20-13-8-9-14(17)15(10-13)19-3;/h4-10H,11H2,1-3H3;1H |
| InChIKey | HBJZZBXYBILTGN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.85 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(4-fluoro-3-methoxyphenyl)sulfanylphenyl]-N,N-dimethylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-fluoro-3-methoxyphenyl)sulfanylphenyl]-N,N-dimethylmethanamine;hydrochloride?
The IUPAC name of 1-[2-(4-fluoro-3-methoxyphenyl)sulfanylphenyl]-N,N-dimethylmethanamine;hydrochloride (CID 67632592) is 1-[2-(4-fluoro-3-methoxyphenyl)sulfanylphenyl]-N,N-dimethylmethanamine;hydrochloride.
What is the SMILES notation for 1-[2-(4-fluoro-3-methoxyphenyl)sulfanylphenyl]-N,N-dimethylmethanamine;hydrochloride?
The canonical SMILES for 1-[2-(4-fluoro-3-methoxyphenyl)sulfanylphenyl]-N,N-dimethylmethanamine;hydrochloride is COc1cc(Sc2ccccc2CN(C)C)ccc1F.Cl.
What is the InChIKey of 1-[2-(4-fluoro-3-methoxyphenyl)sulfanylphenyl]-N,N-dimethylmethanamine;hydrochloride?
The InChIKey is HBJZZBXYBILTGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18FNOS.ClH/c1-18(2)11-12-6-4-5-7-16(12)20-13-8-9-14(17)15(10-13)19-3;/h4-10H,11H2,1-3H3;1H.
What are the key properties of 1-[2-(4-fluoro-3-methoxyphenyl)sulfanylphenyl]-N,N-dimethylmethanamine;hydrochloride?
1-[2-(4-fluoro-3-methoxyphenyl)sulfanylphenyl]-N,N-dimethylmethanamine;hydrochloride has a molecular weight of 327.85 g/mol, XLogP of 4.47, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-fluoro-3-methoxyphenyl)sulfanylphenyl]-N,N-dimethylmethanamine;hydrochloride is sourced from PubChem (CID 67632592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).