C21H25NO6S — CID 20841313
(Z)-but-2-enedioic acid;1-[2-(2,4-dimethoxyphenyl)sulfanylphenyl]-N,N-dimethylmethanamine (PubChem CID 20841313) has the molecular formula C21H25NO6S and a molecular weight of 419.50 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-[2-(2,4-dimethoxyphenyl)sulfanylphenyl]-N,N-dimethylmethanamine.
| Compound Name | (Z)-but-2-enedioic acid;1-[2-(2,4-dimethoxyphenyl)sulfanylphenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 20841313 |
| Molecular Formula | C21H25NO6S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-[2-(2,4-dimethoxyphenyl)sulfanylphenyl]-N,N-dimethylmethanamine |
| SMILES | COc1ccc(Sc2ccccc2CN(C)C)c(OC)c1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C17H21NO2S.C4H4O4/c1-18(2)12-13-7-5-6-8-16(13)21-17-10-9-14(19-3)11-15(17)20-4;5-3(6)1-2-4(7)8/h5-11H,12H2,1-4H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | UFDHVTLFAGJEJC-BTJKTKAUSA-N |
| XLogP | 3.63 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|