C19H19NO6S-2 — CID 20841319
(Z)-but-2-enedioate;[2-(2,4-dimethoxyphenyl)sulfanylphenyl]methanamine (PubChem CID 20841319) has the molecular formula C19H19NO6S-2 and a molecular weight of 389.43 g/mol. Its IUPAC name is (Z)-but-2-enedioate;[2-(2,4-dimethoxyphenyl)sulfanylphenyl]methanamine.
| Compound Name | (Z)-but-2-enedioate;[2-(2,4-dimethoxyphenyl)sulfanylphenyl]methanamine |
|---|---|
| PubChem CID | 20841319 |
| Molecular Formula | C19H19NO6S-2 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | (Z)-but-2-enedioate;[2-(2,4-dimethoxyphenyl)sulfanylphenyl]methanamine |
| SMILES | COc1ccc(Sc2ccccc2CN)c(OC)c1.O=C([O-])/C=C\C(=O)[O-] |
| InChI | InChI=1S/C15H17NO2S.C4H4O4/c1-17-12-7-8-15(13(9-12)18-2)19-14-6-4-3-5-11(14)10-16;5-3(6)1-2-4(7)8/h3-9H,10,16H2,1-2H3;1-2H,(H,5,6)(H,7,8)/p-2/b;2-1- |
| InChIKey | LUKVGHLDTUYFJA-BTJKTKAUSA-L |
| XLogP | 0.36 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|