C10H12O3S — CID 91656983
S-(2,4-dimethoxyphenyl) ethanethioate (PubChem CID 91656983) has the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. Its IUPAC name is S-(2,4-dimethoxyphenyl) ethanethioate.
| Compound Name | S-(2,4-dimethoxyphenyl) ethanethioate |
|---|---|
| PubChem CID | 91656983 |
| Molecular Formula | C10H12O3S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | S-(2,4-dimethoxyphenyl) ethanethioate |
| SMILES | COc1ccc(SC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C10H12O3S/c1-7(11)14-10-5-4-8(12-2)6-9(10)13-3/h4-6H,1-3H3 |
| InChIKey | WIAXICPTGBGNPM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|