C9H10F2O2S — CID 82079729
1-(difluoromethylsulfanyl)-2,4-dimethoxybenzene (PubChem CID 82079729) has the molecular formula C9H10F2O2S and a molecular weight of 220.24 g/mol. Its IUPAC name is 1-(difluoromethylsulfanyl)-2,4-dimethoxybenzene.
| Compound Name | 1-(difluoromethylsulfanyl)-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 82079729 |
| Molecular Formula | C9H10F2O2S |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 1-(difluoromethylsulfanyl)-2,4-dimethoxybenzene |
| SMILES | COc1ccc(SC(F)F)c(OC)c1 |
| InChI | InChI=1S/C9H10F2O2S/c1-12-6-3-4-8(14-9(10)11)7(5-6)13-2/h3-5,9H,1-2H3 |
| InChIKey | WZWIUXADJKIWKS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |