C15H14F2O4S2 — CID 132838821
1-[benzenesulfonyl(difluoro)methyl]sulfanyl-2,4-dimethoxybenzene (PubChem CID 132838821) has the molecular formula C15H14F2O4S2 and a molecular weight of 360.40 g/mol. Its IUPAC name is 1-[benzenesulfonyl(difluoro)methyl]sulfanyl-2,4-dimethoxybenzene.
| Compound Name | 1-[benzenesulfonyl(difluoro)methyl]sulfanyl-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 132838821 |
| Molecular Formula | C15H14F2O4S2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 1-[benzenesulfonyl(difluoro)methyl]sulfanyl-2,4-dimethoxybenzene |
| SMILES | COc1ccc(SC(F)(F)S(=O)(=O)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C15H14F2O4S2/c1-20-11-8-9-14(13(10-11)21-2)22-15(16,17)23(18,19)12-6-4-3-5-7-12/h3-10H,1-2H3 |
| InChIKey | FDRGSPZZNNUMAJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |