C23H20FNO6S — CID 102284536
4-(benzenesulfonyl)-4-fluoro-3-(4-methoxyphenyl)-4-nitro-1-phenylbutan-1-one (PubChem CID 102284536) has the molecular formula C23H20FNO6S and a molecular weight of 457.48 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-4-fluoro-3-(4-methoxyphenyl)-4-nitro-1-phenylbutan-1-one.
| Compound Name | 4-(benzenesulfonyl)-4-fluoro-3-(4-methoxyphenyl)-4-nitro-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 102284536 |
| Molecular Formula | C23H20FNO6S |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 4-(benzenesulfonyl)-4-fluoro-3-(4-methoxyphenyl)-4-nitro-1-phenylbutan-1-one |
| SMILES | COc1ccc(C(CC(=O)c2ccccc2)C(F)([N+](=O)[O-])S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20FNO6S/c1-31-19-14-12-17(13-15-19)21(16-22(26)18-8-4-2-5-9-18)23(24,25(27)28)32(29,30)20-10-6-3-7-11-20/h2-15,21H,16H2,1H3 |
| InChIKey | PGEKFELCWQTLSO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|