C20H23NO5 — CID 101184132
(3R)-3-(3,4-dimethoxyphenyl)-4-methyl-4-nitro-1-phenylpentan-1-one (PubChem CID 101184132) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is (3R)-3-(3,4-dimethoxyphenyl)-4-methyl-4-nitro-1-phenylpentan-1-one.
| Compound Name | (3R)-3-(3,4-dimethoxyphenyl)-4-methyl-4-nitro-1-phenylpentan-1-one |
|---|---|
| PubChem CID | 101184132 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (3R)-3-(3,4-dimethoxyphenyl)-4-methyl-4-nitro-1-phenylpentan-1-one |
| SMILES | COc1ccc([C@@H](CC(=O)c2ccccc2)C(C)(C)[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H23NO5/c1-20(2,21(23)24)16(13-17(22)14-8-6-5-7-9-14)15-10-11-18(25-3)19(12-15)26-4/h5-12,16H,13H2,1-4H3/t16-/m1/s1 |
| InChIKey | AZCQJHPEWXYWGB-MRXNPFEDSA-N |
| XLogP | 4.12 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|