C12H16ClNO4 — CID 13020595
4-(1-chloro-2-methyl-2-nitropropyl)-1,2-dimethoxybenzene (PubChem CID 13020595) has the molecular formula C12H16ClNO4 and a molecular weight of 273.72 g/mol. Its IUPAC name is 4-(1-chloro-2-methyl-2-nitropropyl)-1,2-dimethoxybenzene.
| Compound Name | 4-(1-chloro-2-methyl-2-nitropropyl)-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 13020595 |
| Molecular Formula | C12H16ClNO4 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 4-(1-chloro-2-methyl-2-nitropropyl)-1,2-dimethoxybenzene |
| SMILES | COc1ccc(C(Cl)C(C)(C)[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C12H16ClNO4/c1-12(2,14(15)16)11(13)8-5-6-9(17-3)10(7-8)18-4/h5-7,11H,1-4H3 |
| InChIKey | ACYCAXUZEQVFEB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|