C22H26ClNO7 — CID 101414693
4-[(1S)-1-[(1R)-2-chloro-1-(3,4-dimethoxyphenyl)-2-nitropropoxy]prop-2-enyl]-1,2-dimethoxybenzene (PubChem CID 101414693) has the molecular formula C22H26ClNO7 and a molecular weight of 451.90 g/mol. Its IUPAC name is 4-[(1S)-1-[(1R)-2-chloro-1-(3,4-dimethoxyphenyl)-2-nitropropoxy]prop-2-enyl]-1,2-dimethoxybenzene.
| Compound Name | 4-[(1S)-1-[(1R)-2-chloro-1-(3,4-dimethoxyphenyl)-2-nitropropoxy]prop-2-enyl]-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 101414693 |
| Molecular Formula | C22H26ClNO7 |
| Molecular Weight | 451.90 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 4-[(1S)-1-[(1R)-2-chloro-1-(3,4-dimethoxyphenyl)-2-nitropropoxy]prop-2-enyl]-1,2-dimethoxybenzene |
| SMILES | C=C[C@H](O[C@H](c1ccc(OC)c(OC)c1)C(C)(Cl)[N+](=O)[O-])c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H26ClNO7/c1-7-16(14-8-10-17(27-3)19(12-14)29-5)31-21(22(2,23)24(25)26)15-9-11-18(28-4)20(13-15)30-6/h7-13,16,21H,1H2,2-6H3/t16-,21+,22?/m0/s1 |
| InChIKey | IIBLGPICWQZYEB-ROJLGYONSA-N |
| XLogP | 4.94 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.90 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|