C10H10Cl4O2 — CID 6932906
1,2-dimethoxy-4-[(1R)-1,2,2,2-tetrachloroethyl]benzene (PubChem CID 6932906) has the molecular formula C10H10Cl4O2 and a molecular weight of 304.00 g/mol. Its IUPAC name is 1,2-dimethoxy-4-[(1R)-1,2,2,2-tetrachloroethyl]benzene.
| Compound Name | 1,2-dimethoxy-4-[(1R)-1,2,2,2-tetrachloroethyl]benzene |
|---|---|
| PubChem CID | 6932906 |
| Molecular Formula | C10H10Cl4O2 |
| Molecular Weight | 304.00 g/mol |
| Exact Mass | 301.94 |
| IUPAC Name | 1,2-dimethoxy-4-[(1R)-1,2,2,2-tetrachloroethyl]benzene |
| SMILES | COc1ccc([C@@H](Cl)C(Cl)(Cl)Cl)cc1OC |
| InChI | InChI=1S/C10H10Cl4O2/c1-15-7-4-3-6(5-8(7)16-2)9(11)10(12,13)14/h3-5,9H,1-2H3/t9-/m1/s1 |
| InChIKey | AVANJYCNHDNKEL-SECBINFHSA-N |
| XLogP | 4.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.00 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|