C10H11NO6 — CID 19385042
[(3,4-dimethoxyphenyl)-nitromethyl] formate (PubChem CID 19385042) has the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. Its IUPAC name is [(3,4-dimethoxyphenyl)-nitromethyl] formate.
| Compound Name | [(3,4-dimethoxyphenyl)-nitromethyl] formate |
|---|---|
| PubChem CID | 19385042 |
| Molecular Formula | C10H11NO6 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | [(3,4-dimethoxyphenyl)-nitromethyl] formate |
| SMILES | COc1ccc(C(OC=O)[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C10H11NO6/c1-15-8-4-3-7(5-9(8)16-2)10(11(13)14)17-6-12/h3-6,10H,1-2H3 |
| InChIKey | DSTKQZYKUNIINV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|