About [4-(1-formyloxybut-3-enyl)-2-methoxyphenyl] formate;methane
[4-(1-formyloxybut-3-enyl)-2-methoxyphenyl] formate;methane (PubChem CID 159697446) has the molecular formula C14H18O5
and a molecular weight of 266.29 g/mol. Its IUPAC name is [4-(1-formyloxybut-3-enyl)-2-methoxyphenyl] formate;methane.
Molecular Properties
| Compound Name | [4-(1-formyloxybut-3-enyl)-2-methoxyphenyl] formate;methane |
| PubChem CID | 159697446 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | [4-(1-formyloxybut-3-enyl)-2-methoxyphenyl] formate;methane |
| SMILES | C.C=CCC(OC=O)c1ccc(OC=O)c(OC)c1 |
| InChI | InChI=1S/C13H14O5.CH4/c1-3-4-11(17-8-14)10-5-6-12(18-9-15)13(7-10)16-2;/h3,5-9,11H,1,4H2,2H3;1H4 |
| InChIKey | MXERADZXKORAKX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [4-(1-formyloxybut-3-enyl)-2-methoxyphenyl] formate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1-formyloxybut-3-enyl)-2-methoxyphenyl] formate;methane?
The IUPAC name of [4-(1-formyloxybut-3-enyl)-2-methoxyphenyl] formate;methane (CID 159697446) is [4-(1-formyloxybut-3-enyl)-2-methoxyphenyl] formate;methane.
What is the SMILES notation for [4-(1-formyloxybut-3-enyl)-2-methoxyphenyl] formate;methane?
The canonical SMILES for [4-(1-formyloxybut-3-enyl)-2-methoxyphenyl] formate;methane is C.C=CCC(OC=O)c1ccc(OC=O)c(OC)c1.
What is the InChIKey of [4-(1-formyloxybut-3-enyl)-2-methoxyphenyl] formate;methane?
The InChIKey is MXERADZXKORAKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O5.CH4/c1-3-4-11(17-8-14)10-5-6-12(18-9-15)13(7-10)16-2;/h3,5-9,11H,1,4H2,2H3;1H4.
What are the key properties of [4-(1-formyloxybut-3-enyl)-2-methoxyphenyl] formate;methane?
[4-(1-formyloxybut-3-enyl)-2-methoxyphenyl] formate;methane has a molecular weight of 266.29 g/mol, XLogP of 2.66, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1-formyloxybut-3-enyl)-2-methoxyphenyl] formate;methane is sourced from PubChem (CID 159697446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).