C19H19NO3 — CID 129391063
4-[(1S)-1-(3,4-dimethoxyphenoxy)but-3-enyl]benzonitrile (PubChem CID 129391063) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-[(1S)-1-(3,4-dimethoxyphenoxy)but-3-enyl]benzonitrile.
| Compound Name | 4-[(1S)-1-(3,4-dimethoxyphenoxy)but-3-enyl]benzonitrile |
|---|---|
| PubChem CID | 129391063 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 4-[(1S)-1-(3,4-dimethoxyphenoxy)but-3-enyl]benzonitrile |
| SMILES | C=CC[C@H](Oc1ccc(OC)c(OC)c1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H19NO3/c1-4-5-17(15-8-6-14(13-20)7-9-15)23-16-10-11-18(21-2)19(12-16)22-3/h4,6-12,17H,1,5H2,2-3H3/t17-/m0/s1 |
| InChIKey | SYAWRASEPRCUOI-KRWDZBQOSA-N |
| XLogP | 4.27 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|