C20H20N2O6 — CID 45432859
3-[[2-(4-cyanophenoxy)acetyl]amino]-3-(3,4-dimethoxyphenyl)propanoic acid (PubChem CID 45432859) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is 3-[[2-(4-cyanophenoxy)acetyl]amino]-3-(3,4-dimethoxyphenyl)propanoic acid.
| Compound Name | 3-[[2-(4-cyanophenoxy)acetyl]amino]-3-(3,4-dimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 45432859 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 3-[[2-(4-cyanophenoxy)acetyl]amino]-3-(3,4-dimethoxyphenyl)propanoic acid |
| SMILES | COc1ccc(C(CC(=O)O)NC(=O)COc2ccc(C#N)cc2)cc1OC |
| InChI | InChI=1S/C20H20N2O6/c1-26-17-8-5-14(9-18(17)27-2)16(10-20(24)25)22-19(23)12-28-15-6-3-13(11-21)4-7-15/h3-9,16H,10,12H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | PFKAQWDWHCIVMG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 117.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |