C22H21NO8 — CID 40854125
(3S)-3-(3,4-dimethoxyphenyl)-3-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]propanoic acid (PubChem CID 40854125) has the molecular formula C22H21NO8 and a molecular weight of 427.41 g/mol. Its IUPAC name is (3S)-3-(3,4-dimethoxyphenyl)-3-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]propanoic acid.
| Compound Name | (3S)-3-(3,4-dimethoxyphenyl)-3-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 40854125 |
| Molecular Formula | C22H21NO8 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | (3S)-3-(3,4-dimethoxyphenyl)-3-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]propanoic acid |
| SMILES | COc1ccc([C@H](CC(=O)O)NC(=O)COc2ccc3ccc(=O)oc3c2)cc1OC |
| InChI | InChI=1S/C22H21NO8/c1-28-17-7-4-14(9-19(17)29-2)16(11-21(25)26)23-20(24)12-30-15-6-3-13-5-8-22(27)31-18(13)10-15/h3-10,16H,11-12H2,1-2H3,(H,23,24)(H,25,26)/t16-/m0/s1 |
| InChIKey | UNWKPKROKKBYIF-INIZCTEOSA-N |
| XLogP | 2.52 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|