C18H20O4 — CID 102493094
3-(3,4-dimethoxyphenyl)-3-phenylmethoxypropanal (PubChem CID 102493094) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-3-phenylmethoxypropanal.
| Compound Name | 3-(3,4-dimethoxyphenyl)-3-phenylmethoxypropanal |
|---|---|
| PubChem CID | 102493094 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-3-phenylmethoxypropanal |
| SMILES | COc1ccc(C(CC=O)OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C18H20O4/c1-20-17-9-8-15(12-18(17)21-2)16(10-11-19)22-13-14-6-4-3-5-7-14/h3-9,11-12,16H,10,13H2,1-2H3 |
| InChIKey | PMJVNHJKGMXVND-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|