C23H22O4 — CID 70345355
2-methoxy-4-(2-phenyl-1-phenylmethoxyethyl)benzoic acid (PubChem CID 70345355) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-methoxy-4-(2-phenyl-1-phenylmethoxyethyl)benzoic acid.
| Compound Name | 2-methoxy-4-(2-phenyl-1-phenylmethoxyethyl)benzoic acid |
|---|---|
| PubChem CID | 70345355 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-methoxy-4-(2-phenyl-1-phenylmethoxyethyl)benzoic acid |
| SMILES | COc1cc(C(Cc2ccccc2)OCc2ccccc2)ccc1C(=O)O |
| InChI | InChI=1S/C23H22O4/c1-26-22-15-19(12-13-20(22)23(24)25)21(14-17-8-4-2-5-9-17)27-16-18-10-6-3-7-11-18/h2-13,15,21H,14,16H2,1H3,(H,24,25) |
| InChIKey | VXYSHZCDZITLQM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |