C13H17NO5 — CID 46201853
(4S)-4-(3,4-dimethoxyphenyl)-5-nitropentan-2-one (PubChem CID 46201853) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is (4S)-4-(3,4-dimethoxyphenyl)-5-nitropentan-2-one.
| Compound Name | (4S)-4-(3,4-dimethoxyphenyl)-5-nitropentan-2-one |
|---|---|
| PubChem CID | 46201853 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | (4S)-4-(3,4-dimethoxyphenyl)-5-nitropentan-2-one |
| SMILES | COc1ccc([C@H](CC(C)=O)C[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C13H17NO5/c1-9(15)6-11(8-14(16)17)10-4-5-12(18-2)13(7-10)19-3/h4-5,7,11H,6,8H2,1-3H3/t11-/m1/s1 |
| InChIKey | VDEFMAQKYVRACM-LLVKDONJSA-N |
| XLogP | 2.04 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|