C28H33NO7Si — CID 71544646
(2S,3R)-2,3-bis(3,4-dimethoxyphenyl)-1-[dimethyl(phenyl)silyl]-4-nitrobutan-1-one (PubChem CID 71544646) has the molecular formula C28H33NO7Si and a molecular weight of 523.66 g/mol. Its IUPAC name is (2S,3R)-2,3-bis(3,4-dimethoxyphenyl)-1-[dimethyl(phenyl)silyl]-4-nitrobutan-1-one.
| Compound Name | (2S,3R)-2,3-bis(3,4-dimethoxyphenyl)-1-[dimethyl(phenyl)silyl]-4-nitrobutan-1-one |
|---|---|
| PubChem CID | 71544646 |
| Molecular Formula | C28H33NO7Si |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | (2S,3R)-2,3-bis(3,4-dimethoxyphenyl)-1-[dimethyl(phenyl)silyl]-4-nitrobutan-1-one |
| SMILES | COc1ccc([C@@H](C(=O)[Si](C)(C)c2ccccc2)[C@@H](C[N+](=O)[O-])c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C28H33NO7Si/c1-33-23-14-12-19(16-25(23)35-3)22(18-29(31)32)27(20-13-15-24(34-2)26(17-20)36-4)28(30)37(5,6)21-10-8-7-9-11-21/h7-17,22,27H,18H2,1-6H3/t22-,27+/m0/s1 |
| InChIKey | KOBIEODHXWJGRO-WXVAWEFUSA-N |
| XLogP | 4.59 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|