C24H24ClNO3Si — CID 71546621
(2S,3R)-3-(3-chlorophenyl)-1-[dimethyl(phenyl)silyl]-4-nitro-2-phenylbutan-1-one (PubChem CID 71546621) has the molecular formula C24H24ClNO3Si and a molecular weight of 438.00 g/mol. Its IUPAC name is (2S,3R)-3-(3-chlorophenyl)-1-[dimethyl(phenyl)silyl]-4-nitro-2-phenylbutan-1-one.
| Compound Name | (2S,3R)-3-(3-chlorophenyl)-1-[dimethyl(phenyl)silyl]-4-nitro-2-phenylbutan-1-one |
|---|---|
| PubChem CID | 71546621 |
| Molecular Formula | C24H24ClNO3Si |
| Molecular Weight | 438.00 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | (2S,3R)-3-(3-chlorophenyl)-1-[dimethyl(phenyl)silyl]-4-nitro-2-phenylbutan-1-one |
| SMILES | C[Si](C)(C(=O)[C@H](c1ccccc1)[C@@H](C[N+](=O)[O-])c1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C24H24ClNO3Si/c1-30(2,21-14-7-4-8-15-21)24(27)23(18-10-5-3-6-11-18)22(17-26(28)29)19-12-9-13-20(25)16-19/h3-16,22-23H,17H2,1-2H3/t22-,23+/m0/s1 |
| InChIKey | HEXWZPKFSNFZLM-XZOQPEGZSA-N |
| XLogP | 5.21 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.00 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|