C10H12ClNO2 — CID 101125735
1-chloro-3-[(2R,3S)-3-nitrobutan-2-yl]benzene (PubChem CID 101125735) has the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. Its IUPAC name is 1-chloro-3-[(2R,3S)-3-nitrobutan-2-yl]benzene.
| Compound Name | 1-chloro-3-[(2R,3S)-3-nitrobutan-2-yl]benzene |
|---|---|
| PubChem CID | 101125735 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 1-chloro-3-[(2R,3S)-3-nitrobutan-2-yl]benzene |
| SMILES | C[C@H](c1cccc(Cl)c1)[C@H](C)[N+](=O)[O-] |
| InChI | InChI=1S/C10H12ClNO2/c1-7(8(2)12(13)14)9-4-3-5-10(11)6-9/h3-8H,1-2H3/t7-,8-/m0/s1 |
| InChIKey | QTIDGFZGVGVOQC-YUMQZZPRSA-N |
| XLogP | 3.11 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|