C11H15ClO — CID 165131162
(2R,3S)-3-(3-chlorophenyl)-2-methylbutan-1-ol (PubChem CID 165131162) has the molecular formula C11H15ClO and a molecular weight of 198.69 g/mol. Its IUPAC name is (2R,3S)-3-(3-chlorophenyl)-2-methylbutan-1-ol.
| Compound Name | (2R,3S)-3-(3-chlorophenyl)-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 165131162 |
| Molecular Formula | C11H15ClO |
| Molecular Weight | 198.69 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | (2R,3S)-3-(3-chlorophenyl)-2-methylbutan-1-ol |
| SMILES | C[C@H](c1cccc(Cl)c1)[C@@H](C)CO |
| InChI | InChI=1S/C11H15ClO/c1-8(7-13)9(2)10-4-3-5-11(12)6-10/h3-6,8-9,13H,7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | NEKIHYHJDBNLGY-IUCAKERBSA-N |
| XLogP | 3.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.69 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |