C18H16Cl2N2O4 — CID 54590276
2-acetyl-N-(2,4-dichlorophenyl)-4-nitro-3-phenylbutanamide (PubChem CID 54590276) has the molecular formula C18H16Cl2N2O4 and a molecular weight of 395.24 g/mol. Its IUPAC name is 2-acetyl-N-(2,4-dichlorophenyl)-4-nitro-3-phenylbutanamide.
| Compound Name | 2-acetyl-N-(2,4-dichlorophenyl)-4-nitro-3-phenylbutanamide |
|---|---|
| PubChem CID | 54590276 |
| Molecular Formula | C18H16Cl2N2O4 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 2-acetyl-N-(2,4-dichlorophenyl)-4-nitro-3-phenylbutanamide |
| SMILES | CC(=O)C(C(=O)Nc1ccc(Cl)cc1Cl)C(C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C18H16Cl2N2O4/c1-11(23)17(14(10-22(25)26)12-5-3-2-4-6-12)18(24)21-16-8-7-13(19)9-15(16)20/h2-9,14,17H,10H2,1H3,(H,21,24) |
| InChIKey | ODTWHZOSORCBSC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|