C30H26Cl2N2O — CID 42709927
1-benzhydryl-3-(2,4-dichlorophenyl)-1-[(E)-2-methyl-3-phenylprop-2-enyl]urea (PubChem CID 42709927) has the molecular formula C30H26Cl2N2O and a molecular weight of 501.46 g/mol. Its IUPAC name is 1-benzhydryl-3-(2,4-dichlorophenyl)-1-[(E)-2-methyl-3-phenylprop-2-enyl]urea.
| Compound Name | 1-benzhydryl-3-(2,4-dichlorophenyl)-1-[(E)-2-methyl-3-phenylprop-2-enyl]urea |
|---|---|
| PubChem CID | 42709927 |
| Molecular Formula | C30H26Cl2N2O |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 1-benzhydryl-3-(2,4-dichlorophenyl)-1-[(E)-2-methyl-3-phenylprop-2-enyl]urea |
| SMILES | C/C(=C\c1ccccc1)CN(C(=O)Nc1ccc(Cl)cc1Cl)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H26Cl2N2O/c1-22(19-23-11-5-2-6-12-23)21-34(30(35)33-28-18-17-26(31)20-27(28)32)29(24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-20,29H,21H2,1H3,(H,33,35)/b22-19+ |
| InChIKey | SWPWPYZRPSFUEU-ZBJSNUHESA-N |
| XLogP | 8.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |