C22H20Cl2N2O — CID 4586942
1-(2,4-dichlorophenyl)-3-(3,3-diphenylpropyl)urea (PubChem CID 4586942) has the molecular formula C22H20Cl2N2O and a molecular weight of 399.32 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-(3,3-diphenylpropyl)urea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-(3,3-diphenylpropyl)urea |
|---|---|
| PubChem CID | 4586942 |
| Molecular Formula | C22H20Cl2N2O |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-(3,3-diphenylpropyl)urea |
| SMILES | O=C(NCCC(c1ccccc1)c1ccccc1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H20Cl2N2O/c23-18-11-12-21(20(24)15-18)26-22(27)25-14-13-19(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-12,15,19H,13-14H2,(H2,25,26,27) |
| InChIKey | SURSJIJNWKYZQA-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |